C13H17NO2S2 — CID 45111583
N-[2-(4-hydroxyphenyl)ethyl]-4-methyldithiolane-4-carboxamide (PubChem CID 45111583) has the molecular formula C13H17NO2S2 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-4-methyldithiolane-4-carboxamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-4-methyldithiolane-4-carboxamide |
|---|---|
| PubChem CID | 45111583 |
| Molecular Formula | C13H17NO2S2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-4-methyldithiolane-4-carboxamide |
| SMILES | CC1(C(=O)NCCc2ccc(O)cc2)CSSC1 |
| InChI | InChI=1S/C13H17NO2S2/c1-13(8-17-18-9-13)12(16)14-7-6-10-2-4-11(15)5-3-10/h2-5,15H,6-9H2,1H3,(H,14,16) |
| InChIKey | LLFIOKRHAGGCSB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|