C20H26N4O2 — CID 45111827
2-[7-(4-aminophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(3-methylbutyl)acetamide (PubChem CID 45111827) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[7-(4-aminophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[7-(4-aminophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 45111827 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 2-[7-(4-aminophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CC1CNC(=O)c2cc(-c3ccc(N)cc3)cn21 |
| InChI | InChI=1S/C20H26N4O2/c1-13(2)7-8-22-19(25)10-17-11-23-20(26)18-9-15(12-24(17)18)14-3-5-16(21)6-4-14/h3-6,9,12-13,17H,7-8,10-11,21H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | PULXBIAMPQQSED-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|