C13H21N — CID 45112377
(4aS,7S)-4a-methyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-quinoline (PubChem CID 45112377) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (4aS,7S)-4a-methyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-quinoline.
| Compound Name | (4aS,7S)-4a-methyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-quinoline |
|---|---|
| PubChem CID | 45112377 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (4aS,7S)-4a-methyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-quinoline |
| SMILES | C=C(C)[C@H]1CC[C@@]2(C)CCCN=C2C1 |
| InChI | InChI=1S/C13H21N/c1-10(2)11-5-7-13(3)6-4-8-14-12(13)9-11/h11H,1,4-9H2,2-3H3/t11-,13+/m0/s1 |
| InChIKey | IUOUFRPMLZKTGM-WCQYABFASA-N |
| XLogP | 3.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|