C28H46O4 — CID 45112539
(2S,3S,4R,6S)-4-(methoxymethoxymethyl)-3-methyl-6-(3-methylbut-2-enyl)-3-(4-methylpent-3-enyl)-2-(2-methylpropanoyl)-2-prop-2-enylcyclohexan-1-one (PubChem CID 45112539) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is (2S,3S,4R,6S)-4-(methoxymethoxymethyl)-3-methyl-6-(3-methylbut-2-enyl)-3-(4-methylpent-3-enyl)-2-(2-methylpropanoyl)-2-prop-2-enylcyclohexan-1-one.
| Compound Name | (2S,3S,4R,6S)-4-(methoxymethoxymethyl)-3-methyl-6-(3-methylbut-2-enyl)-3-(4-methylpent-3-enyl)-2-(2-methylpropanoyl)-2-prop-2-enylcyclohexan-1-one |
|---|---|
| PubChem CID | 45112539 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | (2S,3S,4R,6S)-4-(methoxymethoxymethyl)-3-methyl-6-(3-methylbut-2-enyl)-3-(4-methylpent-3-enyl)-2-(2-methylpropanoyl)-2-prop-2-enylcyclohexan-1-one |
| SMILES | C=CC[C@]1(C(=O)C(C)C)C(=O)[C@@H](CC=C(C)C)C[C@@H](COCOC)[C@]1(C)CCC=C(C)C |
| InChI | InChI=1S/C28H46O4/c1-10-15-28(25(29)22(6)7)26(30)23(14-13-21(4)5)17-24(18-32-19-31-9)27(28,8)16-11-12-20(2)3/h10,12-13,22-24H,1,11,14-19H2,2-9H3/t23-,24-,27-,28-/m0/s1 |
| InChIKey | LQIIMMQTGUKPEB-LSGCGUROSA-N |
| XLogP | 6.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|