C32H52O4S — CID 45112774
(1S,5R,7R,8S)-8-(4-methoxy-4-methylpentyl)-8-methyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)-4-methylsulfinylbicyclo[3.3.1]non-2-en-9-one (PubChem CID 45112774) has the molecular formula C32H52O4S and a molecular weight of 532.83 g/mol. Its IUPAC name is (1S,5R,7R,8S)-8-(4-methoxy-4-methylpentyl)-8-methyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)-4-methylsulfinylbicyclo[3.3.1]non-2-en-9-one.
| Compound Name | (1S,5R,7R,8S)-8-(4-methoxy-4-methylpentyl)-8-methyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)-4-methylsulfinylbicyclo[3.3.1]non-2-en-9-one |
|---|---|
| PubChem CID | 45112774 |
| Molecular Formula | C32H52O4S |
| Molecular Weight | 532.83 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | (1S,5R,7R,8S)-8-(4-methoxy-4-methylpentyl)-8-methyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)-4-methylsulfinylbicyclo[3.3.1]non-2-en-9-one |
| SMILES | COC(C)(C)CCC[C@@]1(C)[C@H](CC=C(C)C)C[C@]2(CC=C(C)C)C(=O)[C@@]1(C(=O)C(C)C)C=CC2S(C)=O |
| InChI | InChI=1S/C32H52O4S/c1-22(2)13-14-25-21-31(19-15-23(3)4)26(37(11)35)16-20-32(28(31)34,27(33)24(5)6)30(25,9)18-12-17-29(7,8)36-10/h13,15-16,20,24-26H,12,14,17-19,21H2,1-11H3/t25-,26?,30+,31+,32+,37?/m1/s1 |
| InChIKey | RAVYBVKGFQMVKT-FTWJSOIJSA-N |
| XLogP | 7.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.83 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|