C18H19NO2 — CID 45112904
ethyl 4-methyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carboxylate (PubChem CID 45112904) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is ethyl 4-methyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carboxylate.
| Compound Name | ethyl 4-methyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 45112904 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | ethyl 4-methyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(nc1C)-c1ccccc1CCC2 |
| InChI | InChI=1S/C18H19NO2/c1-3-21-18(20)16-11-14-9-6-8-13-7-4-5-10-15(13)17(14)19-12(16)2/h4-5,7,10-11H,3,6,8-9H2,1-2H3 |
| InChIKey | FWUUSODSRLMPCV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |