C26H27NO4S — CID 45112975
methyl (E,3S,4R)-4-[(4-methylphenyl)sulfonylamino]-3,6-diphenylhex-5-enoate (PubChem CID 45112975) has the molecular formula C26H27NO4S and a molecular weight of 449.57 g/mol. Its IUPAC name is methyl (E,3S,4R)-4-[(4-methylphenyl)sulfonylamino]-3,6-diphenylhex-5-enoate.
| Compound Name | methyl (E,3S,4R)-4-[(4-methylphenyl)sulfonylamino]-3,6-diphenylhex-5-enoate |
|---|---|
| PubChem CID | 45112975 |
| Molecular Formula | C26H27NO4S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | methyl (E,3S,4R)-4-[(4-methylphenyl)sulfonylamino]-3,6-diphenylhex-5-enoate |
| SMILES | COC(=O)C[C@@H](c1ccccc1)[C@@H](/C=C/c1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H27NO4S/c1-20-13-16-23(17-14-20)32(29,30)27-25(18-15-21-9-5-3-6-10-21)24(19-26(28)31-2)22-11-7-4-8-12-22/h3-18,24-25,27H,19H2,1-2H3/b18-15+/t24-,25+/m0/s1 |
| InChIKey | ZVDXTMQWJKLHBR-YRJGGPJPSA-N |
| XLogP | 4.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |