C16H19N3O6S — CID 45113031
N-pyridin-2-yl-4-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentylidene]amino]benzenesulfonamide (PubChem CID 45113031) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is N-pyridin-2-yl-4-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentylidene]amino]benzenesulfonamide.
| Compound Name | N-pyridin-2-yl-4-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 45113031 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-pyridin-2-yl-4-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentylidene]amino]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccn1)c1ccc(/N=C/[C@H](O)[C@@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C16H19N3O6S/c20-10-14(22)16(23)13(21)9-18-11-4-6-12(7-5-11)26(24,25)19-15-3-1-2-8-17-15/h1-9,13-14,16,20-23H,10H2,(H,17,19)/b18-9+/t13-,14+,16+/m0/s1 |
| InChIKey | MSERKJTZPHKVII-KQAKWNKOSA-N |
| XLogP | -0.34 |
| TPSA | 152.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|