C25H26Br2N4O — CID 45113057
8,18-dibromo-10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin (PubChem CID 45113057) has the molecular formula C25H26Br2N4O and a molecular weight of 558.32 g/mol. Its IUPAC name is 8,18-dibromo-10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 8,18-dibromo-10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 45113057 |
| Molecular Formula | C25H26Br2N4O |
| Molecular Weight | 558.32 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | 8,18-dibromo-10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin |
| SMILES | COc1c2nc(cc3cc(Br)c(cc4nc(cc5cc(Br)c1[nH]5)C(C)(C)C4)[nH]3)C(C)(C)C2 |
| InChI | InChI=1S/C25H26Br2N4O/c1-24(2)11-15-8-18-16(26)6-13(28-18)9-21-25(3,4)12-19(31-21)23(32-5)22-17(27)7-14(30-22)10-20(24)29-15/h6-10,28,30H,11-12H2,1-5H3/b13-9-,14-10-,15-8-,18-8-,20-10-,21-9-,23-19+,23-22+ |
| InChIKey | NCLBJIBXFUZEMK-IJXUZEOBSA-N |
| XLogP | 6.89 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.32 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |