C25H28N4O — CID 45113058
10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin (PubChem CID 45113058) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 45113058 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin |
| SMILES | COc1c2nc(cc3ccc(cc4nc(cc5ccc1[nH]5)C(C)(C)C4)[nH]3)C(C)(C)C2 |
| InChI | InChI=1S/C25H28N4O/c1-24(2)13-18-10-15-6-7-16(26-15)11-22-25(3,4)14-20(29-22)23(30-5)19-9-8-17(27-19)12-21(24)28-18/h6-12,26-27H,13-14H2,1-5H3/b15-10-,16-11-,17-12-,18-10-,21-12-,22-11-,23-19+,23-20+ |
| InChIKey | ZKANKVPJBVYWQM-BAUTTXQLSA-N |
| XLogP | 5.36 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |