C18H32O3Si — CID 45113084
[(3R,5R)-3-[2-(1,3-dioxolan-2-yl)ethyl]-5-methyl-2-prop-2-enylcyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 45113084) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is [(3R,5R)-3-[2-(1,3-dioxolan-2-yl)ethyl]-5-methyl-2-prop-2-enylcyclohexen-1-yl]oxy-trimethylsilane.
| Compound Name | [(3R,5R)-3-[2-(1,3-dioxolan-2-yl)ethyl]-5-methyl-2-prop-2-enylcyclohexen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 45113084 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [(3R,5R)-3-[2-(1,3-dioxolan-2-yl)ethyl]-5-methyl-2-prop-2-enylcyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | C=CCC1=C(O[Si](C)(C)C)C[C@H](C)C[C@H]1CCC1OCCO1 |
| InChI | InChI=1S/C18H32O3Si/c1-6-7-16-15(8-9-18-19-10-11-20-18)12-14(2)13-17(16)21-22(3,4)5/h6,14-15,18H,1,7-13H2,2-5H3/t14-,15-/m1/s1 |
| InChIKey | ACBBGJNXFPHMMJ-HUUCEWRRSA-N |
| XLogP | 4.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|