About [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate
[3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate (PubChem CID 45113107) has the molecular formula C22H17FO5
and a molecular weight of 380.37 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate.
Molecular Properties
| Compound Name | [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate |
| PubChem CID | 45113107 |
| Molecular Formula | C22H17FO5 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate |
| SMILES | CC(=O)OC1Oc2cc(C)c(C)cc2-c2oc(=O)c(-c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C22H17FO5/c1-11-8-17-19(9-12(11)2)27-22(26-13(3)24)18-10-16(21(25)28-20(17)18)14-4-6-15(23)7-5-14/h4-10,22H,1-3H3 |
| InChIKey | KIXMBJTVRFRWOF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate?
The IUPAC name of [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate (CID 45113107) is [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate.
What is the SMILES notation for [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate?
The canonical SMILES for [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate is CC(=O)OC1Oc2cc(C)c(C)cc2-c2oc(=O)c(-c3ccc(F)cc3)cc21.
What is the InChIKey of [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate?
The InChIKey is KIXMBJTVRFRWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17FO5/c1-11-8-17-19(9-12(11)2)27-22(26-13(3)24)18-10-16(21(25)28-20(17)18)14-4-6-15(23)7-5-14/h4-10,22H,1-3H3.
What are the key properties of [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate?
[3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate has a molecular weight of 380.37 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-fluorophenyl)-8,9-dimethyl-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate is sourced from PubChem (CID 45113107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).