C33H44N4O — CID 45113164
7,8,17,18-tetraethyl-10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin (PubChem CID 45113164) has the molecular formula C33H44N4O and a molecular weight of 512.74 g/mol. Its IUPAC name is 7,8,17,18-tetraethyl-10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 7,8,17,18-tetraethyl-10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 45113164 |
| Molecular Formula | C33H44N4O |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | 7,8,17,18-tetraethyl-10-methoxy-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin |
| SMILES | CCc1c(CC)c2cc3nc(c(OC)c4[nH]c(cc5nc(cc1[nH]2)CC5(C)C)c(CC)c4CC)CC3(C)C |
| InChI | InChI=1S/C33H44N4O/c1-10-20-21(11-2)25-15-29-33(7,8)18-27(36-29)31(38-9)30-23(13-4)22(12-3)26(37-30)16-28-32(5,6)17-19(34-28)14-24(20)35-25/h14-16,35,37H,10-13,17-18H2,1-9H3/b19-14-,24-14-,25-15-,26-16-,28-16-,29-15-,31-27+,31-30+ |
| InChIKey | JEPWLZDJJUVMPK-RLPISHQWSA-N |
| XLogP | 7.61 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |