C29H23N9S — CID 45113252
2-N-[4-(2-amino-6-thiophen-2-ylpyrimidin-4-yl)phenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 45113252) has the molecular formula C29H23N9S and a molecular weight of 529.63 g/mol. Its IUPAC name is 2-N-[4-(2-amino-6-thiophen-2-ylpyrimidin-4-yl)phenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[4-(2-amino-6-thiophen-2-ylpyrimidin-4-yl)phenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 45113252 |
| Molecular Formula | C29H23N9S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 2-N-[4-(2-amino-6-thiophen-2-ylpyrimidin-4-yl)phenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(-c2ccc(Nc3nc(Nc4ccccc4)nc(Nc4ccccc4)n3)cc2)cc(-c2cccs2)n1 |
| InChI | InChI=1S/C29H23N9S/c30-26-34-23(18-24(35-26)25-12-7-17-39-25)19-13-15-22(16-14-19)33-29-37-27(31-20-8-3-1-4-9-20)36-28(38-29)32-21-10-5-2-6-11-21/h1-18H,(H2,30,34,35)(H3,31,32,33,36,37,38) |
| InChIKey | JFCPWNQCDWZFIW-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |