C17H17N3O2S — CID 45113404
2-methyl-8-pyridin-3-ylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 45113404) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-methyl-8-pyridin-3-ylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-methyl-8-pyridin-3-ylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 45113404 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-methyl-8-pyridin-3-ylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CN1CCc2[nH]c3ccc(S(=O)(=O)c4cccnc4)cc3c2C1 |
| InChI | InChI=1S/C17H17N3O2S/c1-20-8-6-17-15(11-20)14-9-12(4-5-16(14)19-17)23(21,22)13-3-2-7-18-10-13/h2-5,7,9-10,19H,6,8,11H2,1H3 |
| InChIKey | DTTLMZWCZWVYIK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|