About 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one
3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one (PubChem CID 45113521) has the molecular formula C18H19NO5
and a molecular weight of 329.35 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one.
Molecular Properties
| Compound Name | 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one |
| PubChem CID | 45113521 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one |
| SMILES | COc1cc(OCC(O)CO)cc2c1c(=O)c1ccccc1n2C |
| InChI | InChI=1S/C18H19NO5/c1-19-14-6-4-3-5-13(14)18(22)17-15(19)7-12(8-16(17)23-2)24-10-11(21)9-20/h3-8,11,20-21H,9-10H2,1-2H3 |
| InChIKey | PMVPVZRBHDTRHA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one?
The IUPAC name of 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one (CID 45113521) is 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one.
What is the SMILES notation for 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one?
The canonical SMILES for 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one is COc1cc(OCC(O)CO)cc2c1c(=O)c1ccccc1n2C.
What is the InChIKey of 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one?
The InChIKey is PMVPVZRBHDTRHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5/c1-19-14-6-4-3-5-13(14)18(22)17-15(19)7-12(8-16(17)23-2)24-10-11(21)9-20/h3-8,11,20-21H,9-10H2,1-2H3.
What are the key properties of 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one?
3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one has a molecular weight of 329.35 g/mol, XLogP of 1.43, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroxypropoxy)-1-methoxy-10-methylacridin-9-one is sourced from PubChem (CID 45113521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).