C18H19ClFN3O2S — CID 45113653
N-(3-fluorophenyl)-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-sulfonamide;hydrochloride (PubChem CID 45113653) has the molecular formula C18H19ClFN3O2S and a molecular weight of 395.89 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-sulfonamide;hydrochloride.
| Compound Name | N-(3-fluorophenyl)-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 45113653 |
| Molecular Formula | C18H19ClFN3O2S |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-(3-fluorophenyl)-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-sulfonamide;hydrochloride |
| SMILES | CN1CCc2[nH]c3ccc(S(=O)(=O)Nc4cccc(F)c4)cc3c2C1.Cl |
| InChI | InChI=1S/C18H18FN3O2S.ClH/c1-22-8-7-18-16(11-22)15-10-14(5-6-17(15)20-18)25(23,24)21-13-4-2-3-12(19)9-13;/h2-6,9-10,20-21H,7-8,11H2,1H3;1H |
| InChIKey | LEEDRVGVQYVFHX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|