C15H15N3S2 — CID 45113790
5-(4-methylphenyl)-3-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 45113790) has the molecular formula C15H15N3S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-methylphenyl)-3-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 45113790 |
| Molecular Formula | C15H15N3S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-(4-methylphenyl)-3-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cc1ccc(C2=NN(C(N)=S)C(c3cccs3)C2)cc1 |
| InChI | InChI=1S/C15H15N3S2/c1-10-4-6-11(7-5-10)12-9-13(14-3-2-8-20-14)18(17-12)15(16)19/h2-8,13H,9H2,1H3,(H2,16,19) |
| InChIKey | VYTPOAZVTWWCPM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|