C17H26O3 — CID 45113841
1-[(3aR,7aS)-2,2,7-trimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-5-methylhex-4-en-3-ol (PubChem CID 45113841) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-[(3aR,7aS)-2,2,7-trimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-5-methylhex-4-en-3-ol.
| Compound Name | 1-[(3aR,7aS)-2,2,7-trimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-5-methylhex-4-en-3-ol |
|---|---|
| PubChem CID | 45113841 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-[(3aR,7aS)-2,2,7-trimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-5-methylhex-4-en-3-ol |
| SMILES | CC(C)=CC(O)CCC1=CC=C(C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C17H26O3/c1-11(2)10-14(18)9-8-13-7-6-12(3)15-16(13)20-17(4,5)19-15/h6-7,10,14-16,18H,8-9H2,1-5H3/t14?,15-,16+/m0/s1 |
| InChIKey | QWYUNSVFSOHKSJ-MERJSTESSA-N |
| XLogP | 3.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|