C17H20O5 — CID 45113999
(1S,2R,6R,8S)-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-one (PubChem CID 45113999) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is (1S,2R,6R,8S)-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-one.
| Compound Name | (1S,2R,6R,8S)-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-one |
|---|---|
| PubChem CID | 45113999 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (1S,2R,6R,8S)-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-one |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C(=O)CC[C@]3(OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C17H20O5/c1-16(2)21-14-15(22-16)20-13-12(18)8-9-17(13,14)19-10-11-6-4-3-5-7-11/h3-7,13-15H,8-10H2,1-2H3/t13-,14+,15-,17-/m1/s1 |
| InChIKey | JIWHPAUZJQMSPT-JYYAWHABSA-N |
| XLogP | 2.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |