About 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate
1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate (PubChem CID 45114239) has the molecular formula C26H23ClN3O2-
and a molecular weight of 444.94 g/mol. Its IUPAC name is 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate.
Molecular Properties
| Compound Name | 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate |
| PubChem CID | 45114239 |
| Molecular Formula | C26H23ClN3O2- |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate |
| SMILES | O.O=C1N(c2ccccc2)c2ccccc2C1(Cc1ccncc1)Cc1ccncc1.[Cl-] |
| InChI | InChI=1S/C26H21N3O.ClH.H2O/c30-25-26(18-20-10-14-27-15-11-20,19-21-12-16-28-17-13-21)23-8-4-5-9-24(23)29(25)22-6-2-1-3-7-22;;/h1-17H,18-19H2;1H;1H2/p-1 |
| InChIKey | KGPYUCWNMNJORZ-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate?
The IUPAC name of 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate (CID 45114239) is 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate.
What is the SMILES notation for 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate?
The canonical SMILES for 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate is O.O=C1N(c2ccccc2)c2ccccc2C1(Cc1ccncc1)Cc1ccncc1.[Cl-].
What is the InChIKey of 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate?
The InChIKey is KGPYUCWNMNJORZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C26H21N3O.ClH.H2O/c30-25-26(18-20-10-14-27-15-11-20,19-21-12-16-28-17-13-21)23-8-4-5-9-24(23)29(25)22-6-2-1-3-7-22;;/h1-17H,18-19H2;1H;1H2/p-1.
What are the key properties of 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate?
1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate has a molecular weight of 444.94 g/mol, XLogP of 1.06, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-2-one;chloride;hydrate is sourced from PubChem (CID 45114239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).