C20H21NO2S — CID 45115574
2-(2,6-dimethyl-4-phenylthieno[2,3-b]pyridin-5-yl)pentanoic acid (PubChem CID 45115574) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylthieno[2,3-b]pyridin-5-yl)pentanoic acid.
| Compound Name | 2-(2,6-dimethyl-4-phenylthieno[2,3-b]pyridin-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 45115574 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylthieno[2,3-b]pyridin-5-yl)pentanoic acid |
| SMILES | CCCC(C(=O)O)c1c(C)nc2sc(C)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C20H21NO2S/c1-4-8-15(20(22)23)17-13(3)21-19-16(11-12(2)24-19)18(17)14-9-6-5-7-10-14/h5-7,9-11,15H,4,8H2,1-3H3,(H,22,23) |
| InChIKey | PIXMTKSHHDYXTJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |