About 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine
7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine (PubChem CID 45115730) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine.
Molecular Properties
| Compound Name | 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine |
| PubChem CID | 45115730 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine |
| SMILES | CC(C)C1=CC=C2NCCN=C2C=C1 |
| InChI | InChI=1S/C12H16N2/c1-9(2)10-3-5-11-12(6-4-10)14-8-7-13-11/h3-6,9,13H,7-8H2,1-2H3 |
| InChIKey | NSMPVZFCYNMLAW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'colchicine_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine?
The IUPAC name of 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine (CID 45115730) is 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine.
What is the SMILES notation for 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine?
The canonical SMILES for 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine is CC(C)C1=CC=C2NCCN=C2C=C1.
What is the InChIKey of 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine?
The InChIKey is NSMPVZFCYNMLAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-9(2)10-3-5-11-12(6-4-10)14-8-7-13-11/h3-6,9,13H,7-8H2,1-2H3.
What are the key properties of 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine?
7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine has a molecular weight of 188.27 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-yl-3,4-dihydro-2H-cyclohepta[b]pyrazine is sourced from PubChem (CID 45115730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).