About 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde
2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde (PubChem CID 45115742) has the molecular formula C7H12N2O4
and a molecular weight of 188.18 g/mol. Its IUPAC name is 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde.
Molecular Properties
| Compound Name | 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde |
| PubChem CID | 45115742 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde |
| SMILES | CC1CN(C=O)C(O)C(O)N1C=O |
| InChI | InChI=1S/C7H12N2O4/c1-5-2-8(3-10)6(12)7(13)9(5)4-11/h3-7,12-13H,2H2,1H3 |
| InChIKey | SAYDIOJUYWQANF-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde?
The IUPAC name of 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde (CID 45115742) is 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde.
What is the SMILES notation for 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde?
The canonical SMILES for 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde is CC1CN(C=O)C(O)C(O)N1C=O.
What is the InChIKey of 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde?
The InChIKey is SAYDIOJUYWQANF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O4/c1-5-2-8(3-10)6(12)7(13)9(5)4-11/h3-7,12-13H,2H2,1H3.
What are the key properties of 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde?
2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde has a molecular weight of 188.18 g/mol, XLogP of -2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-5-methylpiperazine-1,4-dicarbaldehyde is sourced from PubChem (CID 45115742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).