C8H9NO2 — CID 45115882
1,2,5,8a-tetrahydroindolizine-3,8-dione (PubChem CID 45115882) has the molecular formula C8H9NO2 and a molecular weight of 151.17 g/mol. Its IUPAC name is 1,2,5,8a-tetrahydroindolizine-3,8-dione.
| Compound Name | 1,2,5,8a-tetrahydroindolizine-3,8-dione |
|---|---|
| PubChem CID | 45115882 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 1,2,5,8a-tetrahydroindolizine-3,8-dione |
| SMILES | O=C1C=CCN2C(=O)CCC12 |
| InChI | InChI=1S/C8H9NO2/c10-7-2-1-5-9-6(7)3-4-8(9)11/h1-2,6H,3-5H2 |
| InChIKey | UFXHDNXRYNIIFB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |