About 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one
5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one (PubChem CID 45115960) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one.
Molecular Properties
| Compound Name | 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
| PubChem CID | 45115960 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cc1c[nH]c2c(=O)[nH]c(N)cc12 |
| InChI | InChI=1S/C8H9N3O/c1-4-3-10-7-5(4)2-6(9)11-8(7)12/h2-3,10H,1H3,(H3,9,11,12) |
| InChIKey | JQNCDJZGVXNPGQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
The IUPAC name of 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one (CID 45115960) is 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one.
What is the SMILES notation for 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
The canonical SMILES for 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one is Cc1c[nH]c2c(=O)[nH]c(N)cc12.
What is the InChIKey of 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
The InChIKey is JQNCDJZGVXNPGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-4-3-10-7-5(4)2-6(9)11-8(7)12/h2-3,10H,1H3,(H3,9,11,12).
What are the key properties of 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one has a molecular weight of 163.18 g/mol, XLogP of 0.75, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one is sourced from PubChem (CID 45115960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).