C8H14N2O2 — CID 45116031
(7R,8aS)-7-hydroxy-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one (PubChem CID 45116031) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (7R,8aS)-7-hydroxy-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | (7R,8aS)-7-hydroxy-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 45116031 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (7R,8aS)-7-hydroxy-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one |
| SMILES | CN1CCN2C[C@H](O)C[C@H]2C1=O |
| InChI | InChI=1S/C8H14N2O2/c1-9-2-3-10-5-6(11)4-7(10)8(9)12/h6-7,11H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | OHFBKLJOAXZZTD-RQJHMYQMSA-N |
| XLogP | -1.11 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |