C9H13N3S — CID 45116234
methyl N,N'-dimethyl-N-pyridin-3-ylcarbamimidothioate (PubChem CID 45116234) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is methyl N,N'-dimethyl-N-pyridin-3-ylcarbamimidothioate.
| Compound Name | methyl N,N'-dimethyl-N-pyridin-3-ylcarbamimidothioate |
|---|---|
| PubChem CID | 45116234 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | methyl N,N'-dimethyl-N-pyridin-3-ylcarbamimidothioate |
| SMILES | C/N=C(\SC)N(C)c1cccnc1 |
| InChI | InChI=1S/C9H13N3S/c1-10-9(13-3)12(2)8-5-4-6-11-7-8/h4-7H,1-3H3/b10-9- |
| InChIKey | PGBIXOVWSJWIEL-KTKRTIGZSA-N |
| XLogP | 1.87 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|