3,3-dimethylcyclobutene-1-carboxylic acid

C7H10O2 — CID 45116563

IUPAC3,3-dimethylcyclobutene-1-carboxylic acid
SMILESCC1(C)C=C(C(=O)O)C1
InChIInChI=1S/C7H10O2/c1-7(2)3-5(4-7)6(8)9/h3H,4H2,1-2H3,(H,8,9)
InChIKeyFPDGGJZURPQAMW-UHFFFAOYSA-N
MW126.15 g/mol
LogP1.43
Rot. Bonds1

About 3,3-dimethylcyclobutene-1-carboxylic acid

3,3-dimethylcyclobutene-1-carboxylic acid (PubChem CID 45116563) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is 3,3-dimethylcyclobutene-1-carboxylic acid.

Molecular Properties

Compound Name3,3-dimethylcyclobutene-1-carboxylic acid
PubChem CID45116563
Molecular FormulaC7H10O2
Molecular Weight126.15 g/mol
Exact Mass126.07
IUPAC Name3,3-dimethylcyclobutene-1-carboxylic acid
SMILESCC1(C)C=C(C(=O)O)C1
InChIInChI=1S/C7H10O2/c1-7(2)3-5(4-7)6(8)9/h3H,4H2,1-2H3,(H,8,9)
InChIKeyFPDGGJZURPQAMW-UHFFFAOYSA-N
XLogP1.43
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.15
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3,3-dimethylcyclobutene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethylcyclobutene-1-carboxylic acid?
The IUPAC name of 3,3-dimethylcyclobutene-1-carboxylic acid (CID 45116563) is 3,3-dimethylcyclobutene-1-carboxylic acid.
What is the SMILES notation for 3,3-dimethylcyclobutene-1-carboxylic acid?
The canonical SMILES for 3,3-dimethylcyclobutene-1-carboxylic acid is CC1(C)C=C(C(=O)O)C1.
What is the InChIKey of 3,3-dimethylcyclobutene-1-carboxylic acid?
The InChIKey is FPDGGJZURPQAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-7(2)3-5(4-7)6(8)9/h3H,4H2,1-2H3,(H,8,9).
What are the key properties of 3,3-dimethylcyclobutene-1-carboxylic acid?
3,3-dimethylcyclobutene-1-carboxylic acid has a molecular weight of 126.15 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylcyclobutene-1-carboxylic acid is sourced from PubChem (CID 45116563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).