About 10-methoxyspiro[4.5]deca-6,9-dien-8-one
10-methoxyspiro[4.5]deca-6,9-dien-8-one (PubChem CID 45116909) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 10-methoxyspiro[4.5]deca-6,9-dien-8-one.
Molecular Properties
| Compound Name | 10-methoxyspiro[4.5]deca-6,9-dien-8-one |
| PubChem CID | 45116909 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 10-methoxyspiro[4.5]deca-6,9-dien-8-one |
| SMILES | COC1=CC(=O)C=CC12CCCC2 |
| InChI | InChI=1S/C11H14O2/c1-13-10-8-9(12)4-7-11(10)5-2-3-6-11/h4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | ZFUJSWHOKWAQKP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-methoxyspiro[4.5]deca-6,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methoxyspiro[4.5]deca-6,9-dien-8-one?
The IUPAC name of 10-methoxyspiro[4.5]deca-6,9-dien-8-one (CID 45116909) is 10-methoxyspiro[4.5]deca-6,9-dien-8-one.
What is the SMILES notation for 10-methoxyspiro[4.5]deca-6,9-dien-8-one?
The canonical SMILES for 10-methoxyspiro[4.5]deca-6,9-dien-8-one is COC1=CC(=O)C=CC12CCCC2.
What is the InChIKey of 10-methoxyspiro[4.5]deca-6,9-dien-8-one?
The InChIKey is ZFUJSWHOKWAQKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-13-10-8-9(12)4-7-11(10)5-2-3-6-11/h4,7-8H,2-3,5-6H2,1H3.
What are the key properties of 10-methoxyspiro[4.5]deca-6,9-dien-8-one?
10-methoxyspiro[4.5]deca-6,9-dien-8-one has a molecular weight of 178.23 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxyspiro[4.5]deca-6,9-dien-8-one is sourced from PubChem (CID 45116909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).