C23H19N3O4S2 — CID 4511693
2-(4-phenylphenoxy)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 4511693) has the molecular formula C23H19N3O4S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 2-(4-phenylphenoxy)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-phenylphenoxy)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4511693 |
| Molecular Formula | C23H19N3O4S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 2-(4-phenylphenoxy)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C23H19N3O4S2/c27-22(16-30-20-10-6-18(7-11-20)17-4-2-1-3-5-17)25-19-8-12-21(13-9-19)32(28,29)26-23-24-14-15-31-23/h1-15H,16H2,(H,24,26)(H,25,27) |
| InChIKey | WZMZBKSKPAYRPU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |