About 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid
5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid (PubChem CID 45117097) has the molecular formula C10H7NO4
and a molecular weight of 205.17 g/mol. Its IUPAC name is 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 45117097 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2)[nH]oc1=O |
| InChI | InChI=1S/C10H7NO4/c12-9(13)7-8(11-15-10(7)14)6-4-2-1-3-5-6/h1-5,11H,(H,12,13) |
| InChIKey | TVRRJFOWSUQKDI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid (CID 45117097) is 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid is O=C(O)c1c(-c2ccccc2)[nH]oc1=O.
What is the InChIKey of 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid?
The InChIKey is TVRRJFOWSUQKDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO4/c12-9(13)7-8(11-15-10(7)14)6-4-2-1-3-5-6/h1-5,11H,(H,12,13).
What are the key properties of 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid?
5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid has a molecular weight of 205.17 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 45117097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).