About (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol
(1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol (PubChem CID 45117222) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol.
Molecular Properties
| Compound Name | (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol |
| PubChem CID | 45117222 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol |
| SMILES | O[C@@H]1O[C@H](O)c2ccccc21 |
| InChI | InChI=1S/C8H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4,7-10H/t7-,8+ |
| InChIKey | AONGOYXHASSPAZ-OCAPTIKFSA-N |
| XLogP | 0.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol?
The IUPAC name of (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol (CID 45117222) is (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol.
What is the SMILES notation for (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol?
The canonical SMILES for (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol is O[C@@H]1O[C@H](O)c2ccccc21.
What is the InChIKey of (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol?
The InChIKey is AONGOYXHASSPAZ-OCAPTIKFSA-N. The full InChI is InChI=1S/C8H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4,7-10H/t7-,8+.
What are the key properties of (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol?
(1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol has a molecular weight of 152.15 g/mol, XLogP of 0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R)-1,3-dihydro-2-benzofuran-1,3-diol is sourced from PubChem (CID 45117222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).