About 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine
4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine (PubChem CID 45117367) has the molecular formula C8H11FN2O3
and a molecular weight of 202.19 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine |
| PubChem CID | 45117367 |
| Molecular Formula | C8H11FN2O3 |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine |
| SMILES | COc1cc(OCCF)nc(OC)n1 |
| InChI | InChI=1S/C8H11FN2O3/c1-12-6-5-7(14-4-3-9)11-8(10-6)13-2/h5H,3-4H2,1-2H3 |
| InChIKey | RETKYQCMYOUPFR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine?
The IUPAC name of 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine (CID 45117367) is 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine.
What is the SMILES notation for 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine?
The canonical SMILES for 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine is COc1cc(OCCF)nc(OC)n1.
What is the InChIKey of 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine?
The InChIKey is RETKYQCMYOUPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O3/c1-12-6-5-7(14-4-3-9)11-8(10-6)13-2/h5H,3-4H2,1-2H3.
What are the key properties of 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine?
4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine has a molecular weight of 202.19 g/mol, XLogP of 0.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoroethoxy)-2,6-dimethoxypyrimidine is sourced from PubChem (CID 45117367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).