About 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one
5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one (PubChem CID 45117370) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one |
| PubChem CID | 45117370 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one |
| SMILES | CCc1c(OC)nc(=O)[nH]c1OC |
| InChI | InChI=1S/C8H12N2O3/c1-4-5-6(12-2)9-8(11)10-7(5)13-3/h4H2,1-3H3,(H,9,10,11) |
| InChIKey | RENGYVTXCUBFKQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one?
The IUPAC name of 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one (CID 45117370) is 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one.
What is the SMILES notation for 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one?
The canonical SMILES for 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one is CCc1c(OC)nc(=O)[nH]c1OC.
What is the InChIKey of 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one?
The InChIKey is RENGYVTXCUBFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-4-5-6(12-2)9-8(11)10-7(5)13-3/h4H2,1-3H3,(H,9,10,11).
What are the key properties of 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one?
5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one has a molecular weight of 184.19 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4,6-dimethoxy-1H-pyrimidin-2-one is sourced from PubChem (CID 45117370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).