About 2-(sulfamoylamino)-2,3-dihydro-1H-indene
2-(sulfamoylamino)-2,3-dihydro-1H-indene (PubChem CID 45117541) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-(sulfamoylamino)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 2-(sulfamoylamino)-2,3-dihydro-1H-indene |
| PubChem CID | 45117541 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-(sulfamoylamino)-2,3-dihydro-1H-indene |
| SMILES | NS(=O)(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C9H12N2O2S/c10-14(12,13)11-9-5-7-3-1-2-4-8(7)6-9/h1-4,9,11H,5-6H2,(H2,10,12,13) |
| InChIKey | RUPMWRGJZKCKIZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(sulfamoylamino)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(sulfamoylamino)-2,3-dihydro-1H-indene?
The IUPAC name of 2-(sulfamoylamino)-2,3-dihydro-1H-indene (CID 45117541) is 2-(sulfamoylamino)-2,3-dihydro-1H-indene.
What is the SMILES notation for 2-(sulfamoylamino)-2,3-dihydro-1H-indene?
The canonical SMILES for 2-(sulfamoylamino)-2,3-dihydro-1H-indene is NS(=O)(=O)NC1Cc2ccccc2C1.
What is the InChIKey of 2-(sulfamoylamino)-2,3-dihydro-1H-indene?
The InChIKey is RUPMWRGJZKCKIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c10-14(12,13)11-9-5-7-3-1-2-4-8(7)6-9/h1-4,9,11H,5-6H2,(H2,10,12,13).
What are the key properties of 2-(sulfamoylamino)-2,3-dihydro-1H-indene?
2-(sulfamoylamino)-2,3-dihydro-1H-indene has a molecular weight of 212.27 g/mol, XLogP of -0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(sulfamoylamino)-2,3-dihydro-1H-indene is sourced from PubChem (CID 45117541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).