About N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine
N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine (PubChem CID 45117642) has the molecular formula C9H10N2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine.
Molecular Properties
| Compound Name | N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine |
| PubChem CID | 45117642 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine |
| SMILES | CNCc1cc2cnccc2s1 |
| InChI | InChI=1S/C9H10N2S/c1-10-6-8-4-7-5-11-3-2-9(7)12-8/h2-5,10H,6H2,1H3 |
| InChIKey | NRLQDHIBSGMYGV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine?
The IUPAC name of N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine (CID 45117642) is N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine.
What is the SMILES notation for N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine?
The canonical SMILES for N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine is CNCc1cc2cnccc2s1.
What is the InChIKey of N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine?
The InChIKey is NRLQDHIBSGMYGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S/c1-10-6-8-4-7-5-11-3-2-9(7)12-8/h2-5,10H,6H2,1H3.
What are the key properties of N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine?
N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine has a molecular weight of 178.26 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-thieno[3,2-c]pyridin-2-ylmethanamine is sourced from PubChem (CID 45117642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).