About methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate
methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate (PubChem CID 45117841) has the molecular formula C5H5BrN2O2S
and a molecular weight of 237.08 g/mol. Its IUPAC name is methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate |
| PubChem CID | 45117841 |
| Molecular Formula | C5H5BrN2O2S |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 235.93 |
| IUPAC Name | methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate |
| SMILES | COC(=O)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C5H5BrN2O2S/c1-10-5(9)8-4-7-2-3(6)11-4/h2H,1H3,(H,7,8,9) |
| InChIKey | AILBSSZSXXMLKV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate?
The IUPAC name of methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate (CID 45117841) is methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate is COC(=O)Nc1ncc(Br)s1.
What is the InChIKey of methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate?
The InChIKey is AILBSSZSXXMLKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN2O2S/c1-10-5(9)8-4-7-2-3(6)11-4/h2H,1H3,(H,7,8,9).
What are the key properties of methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate?
methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate has a molecular weight of 237.08 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(5-bromo-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 45117841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).