About methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate
methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate (PubChem CID 45117893) has the molecular formula C6H5ClN2O3S
and a molecular weight of 220.64 g/mol. Its IUPAC name is methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate.
Molecular Properties
| Compound Name | methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate |
| PubChem CID | 45117893 |
| Molecular Formula | C6H5ClN2O3S |
| Molecular Weight | 220.64 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ncc(Cl)s1 |
| InChI | InChI=1S/C6H5ClN2O3S/c1-12-5(11)4(10)9-6-8-2-3(7)13-6/h2H,1H3,(H,8,9,10) |
| InChIKey | TZGVXHPEPWKAIH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.64 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate?
The IUPAC name of methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate (CID 45117893) is methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate.
What is the SMILES notation for methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate?
The canonical SMILES for methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate is COC(=O)C(=O)Nc1ncc(Cl)s1.
What is the InChIKey of methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate?
The InChIKey is TZGVXHPEPWKAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN2O3S/c1-12-5(11)4(10)9-6-8-2-3(7)13-6/h2H,1H3,(H,8,9,10).
What are the key properties of methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate?
methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate has a molecular weight of 220.64 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(5-chloro-1,3-thiazol-2-yl)amino]-2-oxoacetate is sourced from PubChem (CID 45117893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).