About 3-propyl-1,2-oxazole-5-carboxamide
3-propyl-1,2-oxazole-5-carboxamide (PubChem CID 45117964) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-propyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-propyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 45117964 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3-propyl-1,2-oxazole-5-carboxamide |
| SMILES | CCCc1cc(C(N)=O)on1 |
| InChI | InChI=1S/C7H10N2O2/c1-2-3-5-4-6(7(8)10)11-9-5/h4H,2-3H2,1H3,(H2,8,10) |
| InChIKey | NHQGBNSGTAYIRX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-propyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-propyl-1,2-oxazole-5-carboxamide (CID 45117964) is 3-propyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-propyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-propyl-1,2-oxazole-5-carboxamide is CCCc1cc(C(N)=O)on1.
What is the InChIKey of 3-propyl-1,2-oxazole-5-carboxamide?
The InChIKey is NHQGBNSGTAYIRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-2-3-5-4-6(7(8)10)11-9-5/h4H,2-3H2,1H3,(H2,8,10).
What are the key properties of 3-propyl-1,2-oxazole-5-carboxamide?
3-propyl-1,2-oxazole-5-carboxamide has a molecular weight of 154.17 g/mol, XLogP of 0.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 45117964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).