About ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate
ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate (PubChem CID 45118145) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate |
| PubChem CID | 45118145 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\N=C(C)C=C(C)N1CC |
| InChI | InChI=1S/C12H18N2O2/c1-5-14-10(4)7-9(3)13-11(14)8-12(15)16-6-2/h7-8H,5-6H2,1-4H3/b11-8+ |
| InChIKey | OXWZRNWFNHWQCF-DHZHZOJOSA-N |
| XLogP | 2.09 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate?
The IUPAC name of ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate (CID 45118145) is ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate.
What is the SMILES notation for ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate?
The canonical SMILES for ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate is CCOC(=O)/C=C1\N=C(C)C=C(C)N1CC.
What is the InChIKey of ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate?
The InChIKey is OXWZRNWFNHWQCF-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-5-14-10(4)7-9(3)13-11(14)8-12(15)16-6-2/h7-8H,5-6H2,1-4H3/b11-8+.
What are the key properties of ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate?
ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate has a molecular weight of 222.29 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-(1-ethyl-4,6-dimethylpyrimidin-2-ylidene)acetate is sourced from PubChem (CID 45118145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).