About 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole
5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole (PubChem CID 45118183) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole.
Molecular Properties
| Compound Name | 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole |
| PubChem CID | 45118183 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole |
| SMILES | COC1=NC(Cc2ccc[nH]2)C(C)(C)C1 |
| InChI | InChI=1S/C12H18N2O/c1-12(2)8-11(15-3)14-10(12)7-9-5-4-6-13-9/h4-6,10,13H,7-8H2,1-3H3 |
| InChIKey | WHUDWYCWRCPNER-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole?
The IUPAC name of 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole (CID 45118183) is 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole.
What is the SMILES notation for 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole?
The canonical SMILES for 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole is COC1=NC(Cc2ccc[nH]2)C(C)(C)C1.
What is the InChIKey of 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole?
The InChIKey is WHUDWYCWRCPNER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-12(2)8-11(15-3)14-10(12)7-9-5-4-6-13-9/h4-6,10,13H,7-8H2,1-3H3.
What are the key properties of 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole?
5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole has a molecular weight of 206.29 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3,3-dimethyl-2-(1H-pyrrol-2-ylmethyl)-2,4-dihydropyrrole is sourced from PubChem (CID 45118183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).