C14H19N5O3 — CID 45118792
7-(cyclohexylamino)-1,3-dimethyl-5H-pteridine-2,4,6-trione (PubChem CID 45118792) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is 7-(cyclohexylamino)-1,3-dimethyl-5H-pteridine-2,4,6-trione.
| Compound Name | 7-(cyclohexylamino)-1,3-dimethyl-5H-pteridine-2,4,6-trione |
|---|---|
| PubChem CID | 45118792 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 7-(cyclohexylamino)-1,3-dimethyl-5H-pteridine-2,4,6-trione |
| SMILES | Cn1c(=O)c2[nH]c(=O)c(NC3CCCCC3)nc2n(C)c1=O |
| InChI | InChI=1S/C14H19N5O3/c1-18-11-9(13(21)19(2)14(18)22)16-12(20)10(17-11)15-8-6-4-3-5-7-8/h8H,3-7H2,1-2H3,(H,15,17)(H,16,20) |
| InChIKey | DTMUKAVMTWPUDG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |