About N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide
N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 45119209) has the molecular formula C6H6FN3O3
and a molecular weight of 187.13 g/mol. Its IUPAC name is N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide |
| PubChem CID | 45119209 |
| Molecular Formula | C6H6FN3O3 |
| Molecular Weight | 187.13 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | CC(=O)Nn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H6FN3O3/c1-3(11)9-10-2-4(7)5(12)8-6(10)13/h2H,1H3,(H,9,11)(H,8,12,13) |
| InChIKey | YCOVOIDNPFNHIA-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.13 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide?
The IUPAC name of N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide (CID 45119209) is N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide.
What is the SMILES notation for N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide?
The canonical SMILES for N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide is CC(=O)Nn1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide?
The InChIKey is YCOVOIDNPFNHIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN3O3/c1-3(11)9-10-2-4(7)5(12)8-6(10)13/h2H,1H3,(H,9,11)(H,8,12,13).
What are the key properties of N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide?
N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide has a molecular weight of 187.13 g/mol, XLogP of -1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide is sourced from PubChem (CID 45119209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).