About (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one
(1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one (PubChem CID 45119217) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one.
Molecular Properties
| Compound Name | (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one |
| PubChem CID | 45119217 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one |
| SMILES | CC(=O)N1C[C@H]2CC23C=CC(=O)C=C13 |
| InChI | InChI=1S/C11H11NO2/c1-7(13)12-6-8-5-11(8)3-2-9(14)4-10(11)12/h2-4,8H,5-6H2,1H3/t8-,11?/m1/s1 |
| InChIKey | WPWVSBDTHXWUTL-RZZZFEHKSA-N |
| XLogP | 0.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one?
The IUPAC name of (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one (CID 45119217) is (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one.
What is the SMILES notation for (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one?
The canonical SMILES for (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one is CC(=O)N1C[C@H]2CC23C=CC(=O)C=C13.
What is the InChIKey of (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one?
The InChIKey is WPWVSBDTHXWUTL-RZZZFEHKSA-N. The full InChI is InChI=1S/C11H11NO2/c1-7(13)12-6-8-5-11(8)3-2-9(14)4-10(11)12/h2-4,8H,5-6H2,1H3/t8-,11?/m1/s1.
What are the key properties of (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one?
(1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one has a molecular weight of 189.21 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1aS)-3-acetyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one is sourced from PubChem (CID 45119217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).