About propyl 2-oxo-1,3-thiazolidine-3-carboxylate
propyl 2-oxo-1,3-thiazolidine-3-carboxylate (PubChem CID 45119290) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is propyl 2-oxo-1,3-thiazolidine-3-carboxylate.
Molecular Properties
| Compound Name | propyl 2-oxo-1,3-thiazolidine-3-carboxylate |
| PubChem CID | 45119290 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | propyl 2-oxo-1,3-thiazolidine-3-carboxylate |
| SMILES | CCCOC(=O)N1CCSC1=O |
| InChI | InChI=1S/C7H11NO3S/c1-2-4-11-6(9)8-3-5-12-7(8)10/h2-5H2,1H3 |
| InChIKey | AACNAMMZBVXXPB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze propyl 2-oxo-1,3-thiazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-oxo-1,3-thiazolidine-3-carboxylate?
The IUPAC name of propyl 2-oxo-1,3-thiazolidine-3-carboxylate (CID 45119290) is propyl 2-oxo-1,3-thiazolidine-3-carboxylate.
What is the SMILES notation for propyl 2-oxo-1,3-thiazolidine-3-carboxylate?
The canonical SMILES for propyl 2-oxo-1,3-thiazolidine-3-carboxylate is CCCOC(=O)N1CCSC1=O.
What is the InChIKey of propyl 2-oxo-1,3-thiazolidine-3-carboxylate?
The InChIKey is AACNAMMZBVXXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S/c1-2-4-11-6(9)8-3-5-12-7(8)10/h2-5H2,1H3.
What are the key properties of propyl 2-oxo-1,3-thiazolidine-3-carboxylate?
propyl 2-oxo-1,3-thiazolidine-3-carboxylate has a molecular weight of 189.24 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-oxo-1,3-thiazolidine-3-carboxylate is sourced from PubChem (CID 45119290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).