About N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide
N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide (PubChem CID 45119507) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide |
| PubChem CID | 45119507 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide |
| SMILES | CN(OCC1CC1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C10H19NO2/c1-10(2,3)9(12)11(4)13-7-8-5-6-8/h8H,5-7H2,1-4H3 |
| InChIKey | IPMKQXBHDKBHLK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide?
The IUPAC name of N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide (CID 45119507) is N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide.
What is the SMILES notation for N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide?
The canonical SMILES for N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide is CN(OCC1CC1)C(=O)C(C)(C)C.
What is the InChIKey of N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide?
The InChIKey is IPMKQXBHDKBHLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-10(2,3)9(12)11(4)13-7-8-5-6-8/h8H,5-7H2,1-4H3.
What are the key properties of N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide?
N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide has a molecular weight of 185.27 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethoxy)-N,2,2-trimethylpropanamide is sourced from PubChem (CID 45119507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).