About 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol
4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol (PubChem CID 45120026) has the molecular formula C15H16N2OS
and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol.
Molecular Properties
| Compound Name | 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol |
| PubChem CID | 45120026 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol |
| SMILES | CCCNc1nc2c(s1)c(C)c(O)c1ccccc12 |
| InChI | InChI=1S/C15H16N2OS/c1-3-8-16-15-17-12-10-6-4-5-7-11(10)13(18)9(2)14(12)19-15/h4-7,18H,3,8H2,1-2H3,(H,16,17) |
| InChIKey | PSQFOBHZKKNWCD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol?
The IUPAC name of 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol (CID 45120026) is 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol.
What is the SMILES notation for 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol?
The canonical SMILES for 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol is CCCNc1nc2c(s1)c(C)c(O)c1ccccc12.
What is the InChIKey of 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol?
The InChIKey is PSQFOBHZKKNWCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2OS/c1-3-8-16-15-17-12-10-6-4-5-7-11(10)13(18)9(2)14(12)19-15/h4-7,18H,3,8H2,1-2H3,(H,16,17).
What are the key properties of 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol?
4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol has a molecular weight of 272.37 g/mol, XLogP of 4.29, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(propylamino)benzo[e][1,3]benzothiazol-5-ol is sourced from PubChem (CID 45120026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).