About 5-hydroxy-N,1-dimethylimidazole-4-carboxamide
5-hydroxy-N,1-dimethylimidazole-4-carboxamide (PubChem CID 45120270) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 5-hydroxy-N,1-dimethylimidazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-hydroxy-N,1-dimethylimidazole-4-carboxamide |
| PubChem CID | 45120270 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 5-hydroxy-N,1-dimethylimidazole-4-carboxamide |
| SMILES | CNC(=O)c1ncn(C)c1O |
| InChI | InChI=1S/C6H9N3O2/c1-7-5(10)4-6(11)9(2)3-8-4/h3,11H,1-2H3,(H,7,10) |
| InChIKey | CWRJKMRIQYGOMX-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-N,1-dimethylimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-N,1-dimethylimidazole-4-carboxamide?
The IUPAC name of 5-hydroxy-N,1-dimethylimidazole-4-carboxamide (CID 45120270) is 5-hydroxy-N,1-dimethylimidazole-4-carboxamide.
What is the SMILES notation for 5-hydroxy-N,1-dimethylimidazole-4-carboxamide?
The canonical SMILES for 5-hydroxy-N,1-dimethylimidazole-4-carboxamide is CNC(=O)c1ncn(C)c1O.
What is the InChIKey of 5-hydroxy-N,1-dimethylimidazole-4-carboxamide?
The InChIKey is CWRJKMRIQYGOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-7-5(10)4-6(11)9(2)3-8-4/h3,11H,1-2H3,(H,7,10).
What are the key properties of 5-hydroxy-N,1-dimethylimidazole-4-carboxamide?
5-hydroxy-N,1-dimethylimidazole-4-carboxamide has a molecular weight of 155.16 g/mol, XLogP of -0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-N,1-dimethylimidazole-4-carboxamide is sourced from PubChem (CID 45120270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).