C7H8O3 — CID 45120337
3,3-dimethyl-6-oxabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 45120337) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is 3,3-dimethyl-6-oxabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3,3-dimethyl-6-oxabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 45120337 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 3,3-dimethyl-6-oxabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC1(C)C(=O)C2OC2C1=O |
| InChI | InChI=1S/C7H8O3/c1-7(2)5(8)3-4(10-3)6(7)9/h3-4H,1-2H3 |
| InChIKey | KCDIQZYVIAYYCX-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|